BD9417855
(S)-9-Fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-2H-[1,4]oxazino[2,3,4-ij]quinolin-7(3H)-one , 95% , 178964-53-9
Synonym(s):
(S)-(−)-9,10-Difluoro-2,3-dihydro-3-methyl-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid
CAS NO.:178964-53-9
Empirical Formula: C17H20FN3O2
Molecular Weight: 317.36
MDL number: MFCD28016445
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB548.80 | In Stock |
|
| 100mg | RMB877.60 | In Stock |
|
| 250mg | RMB1491.20 | In Stock |
|
| 1g | RMB4024.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-158°C |
| Boiling point: | 501.1±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.37±0.42(Predicted) |
| color | Off-White to Light Yellow |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C17H20FN3O2/c1-11-10-23-17-15-12(14(22)3-4-21(11)15)9-13(18)16(17)20-7-5-19(2)6-8-20/h3-4,9,11H,5-8,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | XTLCAWXSWVQNHK-NSHDSACASA-N |
| SMILES | O1C2=C(N3CCN(C)CC3)C(F)=CC3C(=O)C=CN(C2=3)[C@@H](C)C1 |
| CAS DataBase Reference | 178964-53-9 |
Description and Uses
A degradation product of Levofloxacin (L360000).
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H317-H334 |
| Precautionary statements | P261-P264-P272-P280-P301+P312-P302+P352 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 Skin Sens. 1 |

![(S)-9-Fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-2H-[1,4]oxazino[2,3,4-ij]quinolin-7(3H)-one](https://img.chemicalbook.com/CAS/GIF/178964-53-9.gif)






