LN3607047
DesmethylLevofloxacin , HPLC≥98% , 117707-40-1
Synonym(s):
(S)-9-Fluoro-3-methyl-7-oxo-10-(1-piperazinyl)-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]-benzoxazine-6-carboxylic acid;Desmethyl Levofloxacin
CAS NO.:117707-40-1
Empirical Formula: C17H18FN3O4
Molecular Weight: 347.34
MDL number: MFCD15071265
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >184 °C (Dec.) |
| Boiling point: | 600.7±55.0 °C(Predicted) |
| Density | 1.51±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Aqueous Acid (Slightly, Sonicated), Aqueous Base (Slightly, Sonicated), DMSO (Slightly) |
| form | Solid |
| pka | 5.19±0.40(Predicted) |
| color | Pale Yellow |
| BRN | 6161512 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H18FN3O4/c1-9-8-25-16-13-10(15(22)11(17(23)24)7-21(9)13)6-12(18)14(16)20-4-2-19-3-5-20/h6-7,9,19H,2-5,8H2,1H3,(H,23,24)/t9-/m0/s1 |
| InChIKey | WKRSSAPQZDHYRV-VIFPVBQESA-N |
| SMILES | C[C@H]1COc2c(N3CCNCC3)c(F)cc4C(=O)C(=CN1c24)C(O)=O |
| CAS DataBase Reference | 117707-40-1 |
Description and Uses
A metabolite of Levofloxacin
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







![(S)-9-Fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-2H-[1,4]oxazino[2,3,4-ij]quinolin-7(3H)-one](https://img.chemicalbook.com/CAS/GIF/178964-53-9.gif)