BD8566131
(S)-tert-Butyl 2-(3-amino-2-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetate , 97% , 109010-60-8
CAS NO.:109010-60-8
Empirical Formula: C16H22N2O3
Molecular Weight: 290.36
MDL number: MFCD00895734
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5g | RMB100.00 | In Stock |
|
| 10g | RMB176.00 | In Stock |
|
| 25g | RMB328.00 | In Stock |
|
| 100g | RMB1160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-116°C |
| alpha | -270 º (c=0.5, EtOH) |
| Boiling point: | 483.2±45.0 °C(Predicted) |
| Density | 1.133±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO: ~34 mg/mL, soluble |
| form | solid |
| pka | 7.37±0.20(Predicted) |
| color | white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)21-14(19)10-18-13-7-5-4-6-11(13)8-9-12(17)15(18)20/h4-7,12H,8-10,17H2,1-3H3/t12-/m0/s1 |
| InChIKey | QTEDVVHLTMELTB-LBPRGKRZSA-N |
| SMILES | N1(CC(OC(C)(C)C)=O)C2=CC=CC=C2CC[C@H](N)C1=O |
| CAS DataBase Reference | 109010-60-8(CAS DataBase Reference) |
Description and Uses
S-ATBA is an intermediate in the synthesis of benazepril.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | CX7065000 |
| HS Code | 2933790002 |

![(S)-tert-Butyl 2-(3-amino-2-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetate](https://img.chemicalbook.com/CAS/GIF/109010-60-8.gif)





