BD8572631
5-Methyl-3-phenylisoxazole-4-carboxylic acid , 98% , 1136-45-4
Synonym(s):
5-Methyl-3-phenylisoxazole-4-carboxylic acid
CAS NO.:1136-45-4
Empirical Formula: C11H9NO3
Molecular Weight: 203.19
MDL number: MFCD00003153
EINECS: 214-497-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB79.20 | In Stock |
|
| 5g | RMB239.20 | In Stock |
|
| 25g | RMB620.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-194 °C(lit.) |
| Boiling point: | 341.49°C (rough estimate) |
| Density | 1.2621 (rough estimate) |
| refractive index | 1.4950 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| pka | 2.11±0.32(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 164939 |
| InChI | 1S/C11H9NO3/c1-7-9(11(13)14)10(12-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
| InChIKey | PENHKTNQUJMHIR-UHFFFAOYSA-N |
| SMILES | Cc1onc(-c2ccccc2)c1C(O)=O |
| CAS DataBase Reference | 1136-45-4(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Isoxazolecarboxylic acid, 5-methyl-3-phenyl- (1136-45-4) |
Description and Uses
5-Methyl-3-phenylisoxazole-4-carboxylic acid was used in preparation of intermediates for the synthesis of penicillin. It was used for acylation during solid support synthesis of the isoxazolopyridone derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H313 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 22 |
| Safety Statements | 24/25-36/37-22 |
| WGK Germany | 3 |
| RTECS | NY2750000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |






