BD8593631
(S)-N,N-Dimethyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine oxalate , 95% , 132335-47-8
CAS NO.：132335-47-8
Empirical Formula: C21H23NO5S
Molecular Weight: 401.48
MDL number: MFCD08458302
EINECS: 603-567-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB84.00 | In Stock |
|
| 5g | RMB252.00 | In Stock |
|
| 10g | RMB428.00 | In Stock |
|
| 25g | RMB856.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >145°C (dec.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C19H21NOS.C2H2O4/c1-20(2)13-12-18(19-11-6-14-22-19)21-17-10-5-8-15-7-3-4-9-16(15)17;3-1(4)2(5)6/h3-11,14,18H,12-13H2,1-2H3;(H,3,4)(H,5,6)/t18-;/s3 |
| InChIKey | GYUDMXKAVMKVPS-QAYAHANANA-N |
| SMILES | N(C)(C)CC[C@H](OC1=C2C(C=CC=C2)=CC=C1)C1SC=CC=1.C(O)(=O)C(O)=O |&1:5,r| |
| CAS DataBase Reference | 132335-47-8(CAS DataBase Reference) |
Description and Uses
A duloxetine impurity.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H302-H313-H315-H318 |
| Precautionary statements | P264b-P270-P280-P302+P352-P305+P351+P338-P310-P330-P362+P364-P370+P378r-P403+P233-P501c |
