BD8593931
(S)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid , 98% , 132549-43-0
Synonym(s):
(S)-3-(Boc-amino)-5-methylhexanoic acid;Boc-L -β-homoleucine
CAS NO.:132549-43-0
Empirical Formula: C12H23NO4
Molecular Weight: 245.32
MDL number: MFCD02101665
EINECS: 200-528-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB93.60 | In Stock |
|
| 250mg | RMB140.00 | In Stock |
|
| 1g | RMB432.00 | In Stock |
|
| 5g | RMB1516.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55℃ |
| Boiling point: | 374.3±25.0 °C(Predicted) |
| Density | 1.046±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Very slightly soluble (1.1 g/L at 25°C). |
| pka | 4.45±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| BRN | 4251252 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H23NO4/c1-8(2)6-9(7-10(14)15)13-11(16)17-12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,16)(H,14,15)/t9-/m0/s1 |
| InChIKey | XRVAMBSTOWHUMM-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](CC(O)=O)NC(=O)OC(C)(C)C |
| CAS DataBase Reference | 132549-43-0 |
Description and Uses
(S)-3-(Boc-amino)-5-methylhexanoic acid is used as building blocks for the synthesis of "carba peptides" and building block for β-peptides.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H228-H252 |
| Precautionary statements | P235+P410-P280-P370+P378r-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |







