BD8602231
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoindolin-1-one , 97% , 376584-62-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB246.40 | In Stock |
|
| 250mg | RMB376.80 | In Stock |
|
| 1g | RMB1044.00 | In Stock |
|
| 5g | RMB3698.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 476.6±45.0 °C(Predicted) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 13.95±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | 1S/C14H18BNO3/c1-13(2)14(3,4)19-15(18-13)10-5-6-11-9(7-10)8-16-12(11)17/h5-7H,8H2,1-4H3,(H,16,17) |
| InChIKey | CLACMCLRELMFLJ-UHFFFAOYSA-N |
| SMILES | CC1(OB(C2=CC=C3C(NCC3=C2)=O)OC1(C)C)C |
Description and Uses
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoindolin-1-one is a useful synthetic compound.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
