BD8622955
3,5-Dimethyl-2-cyclohexen-1-one , 95% , 1123-09-7
CAS NO.：1123-09-7
Empirical Formula: C8H12O
Molecular Weight: 124.18
MDL number: MFCD00001583
EINECS: 214-369-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB68.80 | In Stock |
|
| 250mg | RMB107.20 | In Stock |
|
| 1g | RMB272.80 | In Stock |
|
| 5g | RMB985.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 211-212 °C (lit.) |
| Density | 0.881 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 175 °F |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| InChI | InChI=1S/C8H12O/c1-6-3-7(2)5-8(9)4-6/h4,7H,3,5H2,1-2H3 |
| InChIKey | NOQKKFBBAODEHN-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)CC(C)=C1 |
| LogP | 1.141 (est) |
| NIST Chemistry Reference | 2-Cyclohexen-1-one, 3,5-dimethyl-(1123-09-7) |
Description and Uses
3,5-Dimethyl-2-cyclohexen-1-one can be used as a starting material for the synthesis of the intermediate 3,5-dimethyl-2-cyclohexen-1-one.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36-20/21/22 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | 3 |
