BD8623931
1,2-Bis(diphenylphosphino)ethane nickel(II) chloride , 98% , 14647-23-5
Synonym(s):
[1,2-Bis(diphenylphosphino)ethane]nickel(II) chloride;1,2-Ethylenebis(diphenylphosphine)nickel dichloride;dppeNiCl2;Nickel 1,2-Bis(diphenylphosphino)ethane dichloride
CAS NO.:14647-23-5
Empirical Formula: C26H24Cl2NiP2
Molecular Weight: 528.02
MDL number: MFCD00013313
EINECS: 629-489-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB57.60 | In Stock |
|
| 100g | RMB210.40 | In Stock |
|
| 500g | RMB884.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263-265 °C(lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol (Sparingly) |
| form | crystal |
| color | orange |
| Water Solubility | insoluble |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C26H24P2.2ClH.Ni/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2/p-2 |
| InChIKey | XXECWTBMGGXMKP-UHFFFAOYSA-L |
| SMILES | [Ni+2].C(P(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1.[Cl-].[Cl-] |
| CAS DataBase Reference | 14647-23-5(CAS DataBase Reference) |
Description and Uses
Dichloro[bis(1,2-diphenylphosphino)ethane]nickel(II) is a reactant involved in Kumada catalyst-transfer polycondensation, oxidation of carboranyl phosphine ligands, synthesis of nickel-iron dithiolato hydrides, Ullmann reactions - homocoupling reactions, co-catalyst for hydroformylation of alcohols for the synthesis of quaternary carbon centers, catalyst for Wacker-type intramolecular aerobic oxidative amination of alkenes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H319-H334-H335-H350 |
| Precautionary statements | P202-P280-P301+P312-P302+P352+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | T,Xn |
| Risk Statements | 45-20/21/22-36/37/38-42/43-40 |
| Safety Statements | 53-22-26-36-45-52 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |






