BD8627131
(S)-2-Amino-3,3-diphenylpropanoic acid , 97% , 149597-92-2
Synonym(s):
β-Phenyl-L -phenylalanine;(S)-2-Amino-3,3-diphenylpropionic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB70.40 | In Stock |
|
| 1g | RMB272.80 | In Stock |
|
| 5g | RMB1097.60 | In Stock |
|
| 10g | RMB1947.20 | In Stock |
|
| 25g | RMB3870.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-240 °C |
| Boiling point: | 389.2±30.0 °C(Predicted) |
| Density | 1.198±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.11±0.10(Predicted) |
| form | solid |
| color | White |
| Major Application | peptide synthesis |
| InChI | InChI=1/C15H15NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H,16H2,(H,17,18)/t14-/s3 |
| InChIKey | PECGVEGMRUZOML-AWEZNQCLSA-N |
| SMILES | C([C@H](N)C(=O)O)(C1=CC=CC=C1)C1=CC=CC=C1 |&1:1,r| |
| CAS DataBase Reference | 149597-92-2(CAS DataBase Reference) |
Description and Uses
3,3-Diphenyl-L-alanine is used as organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2922498590 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
