BD8721931
H-Phe(3,5-DiF)-OH , 98% , 31105-91-6
CAS NO.：31105-91-6
Empirical Formula: C9H9F2NO2
Molecular Weight: 201.17
MDL number: MFCD01631987
EINECS: 200-528-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.00 | In Stock |
|
| 1g | RMB228.00 | In Stock |
|
| 5g | RMB841.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 295.1±40.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 2.13±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C9H9F2NO2/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | QFGMPXZFCIHYIR-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC(F)=CC(F)=C1)N |
| CAS DataBase Reference | 31105-91-6(CAS DataBase Reference) |
Description and Uses
H-Phe(3,5-DiF)-OH is a difluorophenylalanines in the L-configuration [L-(F2)Phe]. H-Phe(3,5-DiF)-OH can be incorporated into the thrombin receptor-tethered ligand peptide SFLLRNP to identify the phenyl hydrogens of the Phe-2 residue involved in the CH/π receptor interaction[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405 |
| HS Code | 2922498590 |
