BD8675931
Fmoc-β-cyclopropyl-L-Alanine , 95% , 214750-76-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.00 | In Stock |
|
| 1g | RMB151.20 | In Stock |
|
| 5g | RMB660.00 | In Stock |
|
| 10g | RMB1188.00 | In Stock |
|
| 25g | RMB2535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-159°C |
| Boiling point: | 583.5±33.0 °C(Predicted) |
| Density | 1.291±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.89±0.10(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1/C21H21NO4/c23-20(24)19(11-13-9-10-13)22-21(25)26-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18-19H,9-12H2,(H,22,25)(H,23,24)/t19-/s3 |
| InChIKey | DRGUEWQZLABTFG-DETXXQSHNA-N |
| SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2CC2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| CAS DataBase Reference | 214750-76-2(CAS DataBase Reference) |
Description and Uses
Fmoc-L-cyclopropylalanine is used to develop low molecular weight HIV-1 protease dimerization inhibitors. It is also used to prepare piperazinone derivatives as a novel class of potent HCV NS4B inhibitors.
Safety
| HazardClass | IRRITANT |
| HS Code | 29225090 |
