A4369912
Fmoc-<I>N</I>-Me-<SC>D</SC>-Phe-OH , ≥98.0%(HPLC) , 138775-05-0
Synonym(s):
Fmoc-N-methyl-D -phenylalanine
CAS NO.:138775-05-0
Empirical Formula: C25H23NO4
Molecular Weight: 401.45
MDL number: MFCD00153392
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB67.20 | In Stock |
|
| 1G | RMB160.80 | In Stock |
|
| 5G | RMB451.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 595.4±39.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.78±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 8441627 |
| Major Application | peptide synthesis |
| InChI | 1S/C25H23NO4/c1-26(23(24(27)28)15-17-9-3-2-4-10-17)25(29)30-16-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h2-14,22-23H,15-16H2,1H3,(H,27,28)/t23-/m1/s1 |
| InChIKey | GBROUWPNYVBLFO-HSZRJFAPSA-N |
| SMILES | CN([C@H](Cc1ccccc1)C(O)=O)C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 138775-05-0(CAS DataBase Reference) |
Description and Uses
Fmoc-D-MePhe-OH is an intermediate used in the preparation of fluorinated analogs of pepstatin A and grassystatin A that functions as inhibitors of aspartic protease enzymes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |







