A4375712
Fmoc-<I>N</I>-Me-Phe-OH , ≥99.0% , 77128-73-5
Synonym(s):
Fmoc-N-methyl-L -phenylalanine;Fmoc-N-Me-Phe-OH;N-α-Fmoc-N-α-methyl-L-phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB45.60 | In Stock |
|
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB116.80 | In Stock |
|
| 25g | RMB500.00 | In Stock |
|
| 100g | RMB1743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132.0 to 136.0 °C |
| Boiling point: | 595.4±39.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMF. (0.3gram in 2ml) |
| form | Powder |
| pka | 3.78±0.10(Predicted) |
| color | Off-white |
| optical activity | [α]20/D 55.0±3°, c = 1% in DMF |
| BRN | 4768138 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C25H23NO4/c1-26(23(24(27)28)15-17-9-3-2-4-10-17)25(29)30-16-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h2-14,22-23H,15-16H2,1H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | GBROUWPNYVBLFO-QHCPKHFHSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 77128-73-5(CAS DataBase Reference) |
Description and Uses
N-Fmoc-N-methyl-L-phenylalanine is used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 13 - Non Combustible Solids |







