PRODUCT Properties
| Boiling point: | 185-187 °C(lit.) |
| Density | 1.34 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 201 °F |
| storage temp. | 2-8°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
| InChIKey | ODQPZHOXLYATLC-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Cl)C=C2OC1 |
| CAS DataBase Reference | 7228-38-8(CAS DataBase Reference) |
Description and Uses
5-Chloro-1,3-benzodioxole was converted into a safrole derivative via one-pot process involving two consecutive irradiations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P210e-P280a-P405-P501a |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![6-Chloro-2,2-difluorobenzo[d][1,3]dioxol-5-amine](https://img.chemicalbook.com/CAS/GIF/73051-44-2.gif)


![(6-Chlorobenzo[d][1,3]dioxol-5-yl)methanol](https://img.chemicalbook.com/CAS/GIF/2591-25-5.gif)