BD8753831
N-(2,6-Dimethylphenyl)picolinamide , 98% , 39627-98-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB3265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 290.3±35.0 °C(Predicted) |
| Density | 1.165±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.92±0.70(Predicted) |
| color | White to Pale Brown |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C14H14N2O/c1-10-6-5-7-11(2)13(10)16-14(17)12-8-3-4-9-15-12/h3-9H,1-2H3,(H,16,17) |
| InChIKey | SHZDEASIMRREIQ-UHFFFAOYSA-N |
| SMILES | N(c2c(cccc2C)C)C(=O)c1ncccc1 |
| CAS DataBase Reference | 39627-98-0(CAS DataBase Reference) |
| EPA Substance Registry System | N-(2,6-Dimethylphenyl)-2-picolinamide (39627-98-0) |
Description and Uses
Bupivacaine impurity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |







