BD8766031
(2-Aminophenyl)(pyridin-2-yl)methanone , 95+% , 42471-56-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB896.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| Boiling point: | 411.4±25.0 °C(Predicted) |
| Density | 1.215 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| pka | 2.75±0.10(Predicted) |
| form | Solid |
| color | Yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C12H10N2O/c13-10-6-2-1-5-9(10)12(15)11-7-3-4-8-14-11/h1-8H,13H2 |
| InChIKey | WEWXXYDHYCDEKY-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1N)(C1=NC=CC=C1)=O |
| CAS DataBase Reference | 42471-56-7(CAS DataBase Reference) |
Description and Uses
2-(2-Aminobenzoyl)pyridine, is an intermediate used for the synthesis of various Quinoline derivatives. It can also be used in the synthesis of the antitumoral agent batracylin and related isoindolo[1,2-b]quinazolin-12(10H)-ones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501 |






