BD8801731
tert-Butyl endo-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate , 96% , 207405-68-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB84.80 | In Stock |
|
| 250mg | RMB126.40 | In Stock |
|
| 1g | RMB280.00 | In Stock |
|
| 5g | RMB951.20 | In Stock |
|
| 10g | RMB1660.00 | In Stock |
|
| 25g | RMB3320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 313.2±35.0 °C(Predicted) |
| Density | 1.084 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 10.12±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1/C12H22N2O2/c1-12(2,3)16-11(15)14-9-4-5-10(14)7-8(13)6-9/h8-10H,4-7,13H2,1-3H3/t9-,10-/s3 |
| InChIKey | NZJKEPNCNBWESN-DPIMBTEZNA-N |
| SMILES | C(=O)(OC(C)(C)C)N1[C@H]2CC[C@H]1C[C@H](N)C2 |&1:8,11,13,r| |
| CAS DataBase Reference | 207405-68-3 |
Description and Uses
N-Boc-endo-3-aminotropane is used as a reagent in the synthesis of tropane-derived CCR5 receptor antagonists.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H302-H335-H318 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P280-P305+P351+P338-P310 |
| HS Code | 2924297099 |

![tert-Butyl endo-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate](https://img.chemicalbook.com/CAS/GIF/207405-68-3.gif)





![tert-Butyl exo-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate](https://img.chemicalbook.com/CAS/GIF/744183-20-8.gif)
