BD8840747
(S)-N-(7-Amino-1-chloro-2-oxoheptan-3-yl)-4-methylbenzenesulfonamidehydrochloride , 95+% , 4272-74-6
Synonym(s):
(3S)-1-Chloro-3-tosylamido-7-amino-2-heptanone hydrochloride;(3S)-7-Amino-1-chloro-3-tosylamino-2-heptanone hydrochloride;TLCK;Tosyl-L -lysyl-chloromethane hydrochloride
CAS NO.：4272-74-6
Empirical Formula: C14H22Cl2N2O3S
Molecular Weight: 369.31
MDL number: MFCD00065395
EINECS: 224-266-4
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~165 °C (dec.) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white to pink |
| biological source | synthetic (organic) |
| optical activity | [α]20/D 7.8±0.5°, c = 2% in H2O |
| Water Solubility | H2O: 50mg/mL |
| BRN | 7106867 |
| InChI | 1S/C14H21ClN2O3S.ClH/c1-11-5-7-12(8-6-11)21(19,20)17-13(14(18)10-15)4-2-3-9-16;/h5-8,13,17H,2-4,9-10,16H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | YFCUZWYIPBUQBD-ZOWNYOTGSA-N |
| SMILES | Cl[H].Cc1ccc(cc1)S(=O)(=O)N[C@@H](CCCCN)C(=O)CCl |
| CAS DataBase Reference | 4272-74-6 |
Description and Uses
Nα-Tosyl-L-lysine chloromethyl ketone hydrochloride has been used:
- in chymotrypsin purification to prevent binding of trypsins to the affinity support by inhibiting them in the crude extract
- as a protease inhibitor in tissue and cell homogenization
- as a trypsin inhibitor to determine the specific protease activity levels
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P304+P340-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | XT5160000 |
| F | 10-21 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
