BD8845531
2-Aminomalonamide , 97% , 62009-47-6
CAS NO.：62009-47-6
Empirical Formula: C3H7N3O2
Molecular Weight: 117.11
MDL number: MFCD00015932
EINECS: 263-370-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB16.00 | In Stock |
|
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB28.80 | In Stock |
|
| 25g | RMB43.20 | In Stock |
|
| 100g | RMB156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-185°C |
| Boiling point: | 410.1±40.0 °C(Predicted) |
| Density | 1.399±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Sparingly), Methanol (Sparingly) |
| form | Solid |
| pka | 9.87±0.70(Predicted) |
| color | Pale Yellow to Beige |
| InChI | InChI=1S/C3H7N3O2/c4-1(2(5)7)3(6)8/h1H,4H2,(H2,5,7)(H2,6,8) |
| InChIKey | GFQBSQXXHYLABK-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C(N)C(N)=O |
| CAS DataBase Reference | 62009-47-6 |
Description and Uses
2-aminopropanediamide is a reagent used in the synthesis of Imidazole derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 2924190090 |
