BD8854831
Ethyl 5-methyl-1H-imidazole-4-carboxylate , 98% , 51605-32-4
CAS NO.:51605-32-4
Empirical Formula: C7H10N2O2
Molecular Weight: 154.17
MDL number: MFCD00005199
EINECS: 257-315-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB65.60 | In Stock |
|
| 10g | RMB107.20 | In Stock |
|
| 25g | RMB250.40 | In Stock |
|
| 100g | RMB908.80 | In Stock |
|
| 500g | RMB4080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C (lit.) |
| Boiling point: | 323.7±22.0 °C(Predicted) |
| Density | 1.171±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform/methanol: soluble50mg/mL, clear, colorless to light yellow |
| pka | 11.47±0.10(Predicted) |
| form | Crystalline Powder or Crystals |
| color | Off-white to tan |
| InChI | InChI=1S/C7H10N2O2/c1-3-11-7(10)6-5(2)8-4-9-6/h4H,3H2,1-2H3,(H,8,9) |
| InChIKey | VLDUBDZWWNLZCU-UHFFFAOYSA-N |
| SMILES | C1NC(C(OCC)=O)=C(C)N=1 |
| EPA Substance Registry System | 1H-Imidazole-4-carboxylic acid, 5-methyl-, ethyl ester (51605-32-4) |
Description and Uses
Ethyl 4-methyl-5-imidazolecarboxylate forms coordination compounds with Co(2+). These compounds inhibit photosynthetic electron flow and ATP-synthesis and acts as Hill reaction inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P501-P270-P264-P301+P312+P330 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |



![Ethyl2,6-dimethylimidazo[1,2-a]pyridine-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/81438-51-9.gif)
![Ethyl 2-phenylimidazo[1,2-a]pyridine-3-carboxylate](https://img.chemicalbook.com/StructureFile/ChemBookStructure2/GIF/CB2195005.gif)

