BD8862847
1-Tosylaziridine , 98% , 3634-89-7
Synonym(s):
N-(p-Toluenesulfonyl)aziridine;N-(p-Tolylsulfonyl)aziridine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB80.00 | In Stock |
|
| 1g | RMB206.40 | In Stock |
|
| 5g | RMB928.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-56 °C |
| Boiling point: | 322.3±35.0 °C(Predicted) |
| Density | 1.334±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | crystals |
| pka | -6.46±0.20(Predicted) |
| Appearance | White to light yellow Solid |
| BRN | 154388 |
| InChI | InChI=1S/C9H11NO2S/c1-8-2-4-9(5-3-8)13(11,12)10-6-7-10/h2-5H,6-7H2,1H3 |
| InChIKey | VBNWSEVVMYMVLC-UHFFFAOYSA-N |
| SMILES | N1(S(C2=CC=C(C)C=C2)(=O)=O)CC1 |
Description and Uses
Reagent for beta-aminoethylation as well as for chemical fixation of carbon dioxide via ring expansion reaction under atmospheric pressure.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2935909099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




