BD8876255
(1E,6E)-1,7-Bis(3,4-dimethoxyphenyl)-4,4-dimethylhepta-1,6-diene-3,5-dione , 95% , 52328-97-9
Synonym(s):
(E,E)-1,7-Bis(3,4-dimethoxyphenyl)-4,4-dimethyl-1,6-heptadiene-3,5-dione;Tetramethylcurcumin
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1865.60 | In Stock |
|
| 50mg | RMB2798.40 | In Stock |
|
| 100mg | RMB4197.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 594.5±50.0 °C(Predicted) |
| Density | 1.140±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥10mg/mL |
| form | powder |
| color | yellow |
| InChI | 1S/C25H28O6/c1-25(2,23(26)13-9-17-7-11-19(28-3)21(15-17)30-5)24(27)14-10-18-8-12-20(29-4)22(16-18)31-6/h7-16H,1-6H3/b13-9+,14-10+ |
| InChIKey | VMMZAMVBGQWOHT-UTLPMFLDSA-N |
| SMILES | COc1ccc(\C=C\C(=O)C(C)(C)C(=O)\C=C\c2ccc(OC)c(OC)c2)cc1OC |
Description and Uses
Tetramethylcurcumin (FLLL31), derived from curcumin, specifically suppresses the phosphorylation of STAT3 by binding selectively to Janus kinase 2 and the STAT3 Src homology-2 domain. Tetramethylcurcumin exhibits anti-inflammatory and anti-cancer effects[1][2].
