BD8782447
Monodemethoxycurcumin , 98% , 22608-11-3
Synonym(s):
(E,E)-1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione;Curcumin II;Desmethoxycurcumin;Monodemethoxycurcumin
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB772.80 | In Stock |
|
| 100mg | RMB1081.60 | In Stock |
|
| 250mg | RMB1622.40 | In Stock |
|
| 1g | RMB4056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166~170℃ |
| Boiling point: | 571.4±50.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥10mg/mL |
| pka | 8.31±0.46(Predicted) |
| form | powder |
| color | orange |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | 1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3/b9-4+,10-5+ |
| InChIKey | HJTVQHVGMGKONQ-LUZURFALSA-N |
| SMILES | COc1cc(\C=C\C(=O)CC(=O)\C=C\c2ccc(O)cc2)ccc1O |
| LogP | 3.113 (est) |
Description and Uses
The demethoxy derivative of Curcumin (C838500) that regulates anti-inflammatory and anti-proliferative responses through a ROS-independent mechanism. It attenuates the Wnt/β-catenin pathway through do wn-regulation of the transcriptional coactivator p300.






