BD8884955
3,6,9,12,15,18,21,24,27,30,33,36-Dodecaoxaoctatriacontane-1,38-diol , 95% , 17598-96-8
CAS NO.:17598-96-8
Empirical Formula: C26H54O14
Molecular Weight: 590.699
MDL number: MFCD20926392
EINECS: 2415697
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB140.80 | In Stock |
|
| 250mg | RMB220.80 | In Stock |
|
| 1g | RMB569.60 | In Stock |
|
| 5g | RMB2064.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 631.6±50.0 °C(Predicted) |
| Density | 1.116±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 14.06±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C26H54O14/c27-1-3-29-5-7-31-9-11-33-13-15-35-17-19-37-21-23-39-25-26-40-24-22-38-20-18-36-16-14-34-12-10-32-8-6-30-4-2-28/h27-28H,1-26H2 |
| InChIKey | AKWFJQNBHYVIPY-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Description and Uses
PEG14 is a PEG chain consisting of 13 ethylene glycol subunits and two terminal hydroxyl groups. The hydroxyl groups can participate in reactions to further derivatize the compound. The hydrophilic PEG chain increases the water solubility of the compound in aqueous media. The water solubility properties of the PEG linker are enhanced with longer PEG chains.
HO-PEG13-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |







