BD8889747
1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylicacid , 95+% , 139756-00-6
CAS NO.：139756-00-6
Empirical Formula: C8H11N3O4
Molecular Weight: 213.19
MDL number: MFCD02110857
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB84.00 | In Stock |
|
| 250mg | RMB125.60 | In Stock |
|
| 1g | RMB312.80 | In Stock |
|
| 5g | RMB1094.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-127 °C |
| Boiling point: | 392.7±42.0 °C(Predicted) |
| Density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.16±0.50(Predicted) |
| color | Yellow to Orange to Dark Yellow |
| InChI | InChI=1S/C8H11N3O4/c1-3-4-5-6(11(14)15)7(8(12)13)10(2)9-5/h3-4H2,1-2H3,(H,12,13) |
| InChIKey | GFORSNBMYCLGIE-UHFFFAOYSA-N |
| SMILES | N1(C)C(C(O)=O)=C([N+]([O-])=O)C(CCC)=N1 |
Description and Uses
Intermediate in the production of Sildenafil.
