BD8915731
(6R,7R)-7-Amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid , 96% , 53994-69-7
CAS NO.:53994-69-7
Empirical Formula: C7H7ClN2O3S
Molecular Weight: 234.66
MDL number: MFCD09039101
EINECS: 258-907-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB80.80 | In Stock |
|
| 250mg | RMB120.80 | In Stock |
|
| 1g | RMB300.80 | In Stock |
|
| 5g | RMB708.80 | In Stock |
|
| 10g | RMB1382.40 | In Stock |
|
| 25g | RMB3316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >180°C (dec.) |
| Boiling point: | 498.9±45.0 °C(Predicted) |
| Density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Acid (Slightly, Heated), DMSO (Slightly, Heated, Sonicated) |
| pka | 1.87±0.50(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C7H7ClN2O3S/c8-2-1-14-6-3(9)5(11)10(6)4(2)7(12)13/h3,6H,1,9H2,(H,12,13)/t3-,6-/m1/s1 |
| InChIKey | OQSAFIZCBAZPMY-AWFVSMACSA-N |
| SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(Cl)=C2C(O)=O |
| CAS DataBase Reference | 53994-69-7(CAS DataBase Reference) |
Description and Uses
7-Amino-3-chloro cephalosporanic acid is used as an intermediate in the preparation of semi-synthetic cephalosprin antibiotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |

![(6R,7R)-7-Amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/53994-69-7.gif)


![(6R-trans)-7-[(2,2-diMethyl-1-oxopropyl)aMino]-3-Methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-](https://img.chemicalbook.com/CAS/GIF/146794-70-9.gif)


