BD8923131
Zeaxanthin , 98% , 144-68-3
Synonym(s):
β,β-Carotene-3,3′-diol
CAS NO.：144-68-3
Empirical Formula: C40H56O2
Molecular Weight: 568.87
MDL number: MFCD00075654
EINECS: 205-636-4
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB405.60 | In Stock |
|
| 5mg | RMB806.40 | In Stock |
|
| 10mg | RMB1372.80 | In Stock |
|
| 50mg | RMB2740.80 | In Stock |
|
| 100mg | RMB4654.40 | In Stock |
|
| 250mg | RMB5896.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-2050C |
| Boiling point: | 572.66°C (rough estimate) |
| Density | 0.9944 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.60±0.70(Predicted) |
| form | Solid |
| color | Light Orange to Very Dark Red |
| Odor | Special Odor |
| Stability: | Light Sensitive, Temperature Sensitive |
| InChIKey | JKQXZKUSFCKOGQ-SLJWWQRENA-N |
| SMILES | C1(/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2C(C)(C)C[C@H](O)CC=2C)C(C)(C)C[C@H](O)CC=1C |&1:28,37,r| |
| LogP | 14.950 (est) |
| CAS DataBase Reference | 144-68-3(CAS DataBase Reference) |
Description and Uses
It is one of the two carotenoids contained within the retina.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P302+P352-P305+P351+P338-P362+P364 |
| WGK Germany | - |
| F | 3-8-10 |
| HS Code | 29062990 |
