BD8923231
4-Methoxy-2,3,6-trimethylbenzaldehyde , 95% , 54344-92-2
CAS NO.:54344-92-2
Empirical Formula: C11H14O2
Molecular Weight: 178.23
MDL number: MFCD00456729
EINECS: 259-117-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB75.20 | In Stock |
|
| 25g | RMB249.60 | In Stock |
|
| 100g | RMB862.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63.0 to 68.0 °C |
| Boiling point: | 301.2±37.0 °C(Predicted) |
| Density | 1.024±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate, Tetrahydrofuran |
| form | Solid |
| color | White |
| InChI | InChI=1S/C11H14O2/c1-7-5-11(13-4)9(3)8(2)10(7)6-12/h5-6H,1-4H3 |
| InChIKey | BTOFIDLWQJCUJG-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C)C=C(OC)C(C)=C1C |
Description and Uses
4-Methoxy-2,3,6-trimethylbenzaldehyde (cas# 54344-92-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | WGK 2 |
| HS Code | 2912.49.2600 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |






