BD8926855
1'-Hydroxy-2'-acetonaphthone , 98% , 711-79-5
Synonym(s):
2-Acetyl-1-naphthol
CAS NO.：711-79-5
Empirical Formula: C12H10O2
Molecular Weight: 186.21
MDL number: MFCD00003963
EINECS: 211-918-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB104.00 | In Stock |
|
| 25g | RMB375.20 | In Stock |
|
| 100g | RMB1372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C(lit.) |
| Boiling point: | 280.69°C (rough estimate) |
| Density | 1.1032 (rough estimate) |
| refractive index | 1.6086 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | pK1: 13.40 (30°C) |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | Insoluble in water. |
| BRN | 1868084 |
| InChI | InChI=1S/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| InChIKey | JBGJVMVWYWUVOW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C2C(=C1O)C=CC=C2)C |
| EPA Substance Registry System | Ethanone, 1-(1-hydroxy-2-naphthalenyl)- (711-79-5) |
Description and Uses
2-acetyl-1-naphthol and 1-acetyl-2-naphthol with triphosgene gave naphtho[1,2-e]-1,3-oxazines, naphtho[2,1-e]-1,3-oxazines or their spiro dimers depending on the molar ratio of triphosgene used for the cyclization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29145000 |
