LN0209454
96% , 17648-03-2
Synonym(s):
Leucoquinizarin
CAS NO.：17648-03-2
Empirical Formula: C14H10O4
Molecular Weight: 242.23
MDL number: MFCD00012251
EINECS: 241-631-3
| Pack Size | Price | Stock | Quantity |
| 100g | RMB714.40 | In Stock |
|
| 500g | RMB1837.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-157 °C(lit.) |
| Boiling point: | 575.8±50.0 °C(Predicted) |
| Density | 1.511±0.06 g/cm3(Predicted) |
| pka | 7?+-.0.20(Predicted) |
| form | solid |
| InChI | 1S/C14H10O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-4,17-18H,5-6H2 |
| InChIKey | FVXPBEUYCCZFJT-UHFFFAOYSA-N |
| SMILES | Oc1c2C(=O)CCC(=O)c2c(O)c3ccccc13 |
| EPA Substance Registry System | 1,4-Anthracenedione, 2,3-dihydro-9,10-dihydroxy- (17648-03-2) |
Description and Uses
9,10-Dihydroxy-2,3-dihydroanthracene-1,4-dione can be used for textile dyeing and antileukemia agents
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
