BD8933355
Benzoicacid-d5 , 98%98atom%D , 1079-02-3
Synonym(s):
Benzoic-d5 acid-(phenyl-d5);Deuterated benzoic acid
CAS NO.：1079-02-3
Empirical Formula: C7HD5O2
Molecular Weight: 127.15
MDL number: MFCD00002400
EINECS: 214-089-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB188.80 | In Stock |
|
| 1g | RMB490.40 | In Stock |
|
| 5g | RMB1714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-125 °C(lit.) |
| Boiling point: | 249 °C(lit.) |
| storage temp. | Refrigerator |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly), Methan |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i1D,2D,3D,4D,5D |
| InChIKey | WPYMKLBDIGXBTP-RALIUCGRSA-N |
| SMILES | C(C1C([2H])=C([2H])C([2H])=C([2H])C=1[2H])(=O)O |
| CAS Number Unlabeled | 65-85-0 |
Description and Uses
Benzoic Acid-d5 can be intended for use as an internal standard for the quantification of Benzoic Acid by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H334-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P342+P311 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-42/43 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| Autoignition Temperature | 1061 °F |
| HS Code | 28459010 |
