BD8944631
H-DL-Trp-OMe.HCl , 97% , 5619-09-0
CAS NO.：5619-09-0
Empirical Formula: C12H15ClN2O2
Molecular Weight: 254.71
MDL number: MFCD00066133
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB46.40 | In Stock |
|
| 25g | RMB92.00 | In Stock |
|
| 100g | RMB361.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-222 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol, Water |
| form | Solid |
| color | Off-white to white |
| InChI | InChI=1S/C12H14N2O2.ClH/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11;/h2-5,7,10,14H,6,13H2,1H3;1H |
| InChIKey | XNFNGGQRDXFYMM-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC=1NC=C2CC(N)C(=O)OC.Cl |
| CAS DataBase Reference | 5619-09-0(CAS DataBase Reference) |
Description and Uses
Amino acid derivative， D,L-Tryptophan Methyl Ester Hydrochloride may be used to prepare the corresponding amino acid amide L-Tryptophanamide Hydrochloride (Cat. #T89550)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338-P362+P364 |
| Hazard Codes | Xi,Xn |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
