BD8955431
2-(2-Chloroethyl)-1-methylpyrrolidine hydrochloride , 95+% , 56824-22-7
CAS NO.:56824-22-7
Empirical Formula: C7H15Cl2N
Molecular Weight: 184.1
MDL number: MFCD00012717
EINECS: 260-395-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB224.80 | In Stock |
|
| 5g | RMB785.60 | In Stock |
|
| 10g | RMB1334.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Beige to Beige |
| optical activity | -0.3232° (C=0.5415 g/100ml, CHCL3) |
| BRN | 6148386 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H14ClN.ClH/c1-9-6-2-3-7(9)4-5-8;/h7H,2-6H2,1H3;1H |
| InChIKey | KCQMALZNENFGKK-UHFFFAOYSA-N |
| SMILES | C(C1CCCN1C)CCl.Cl |
| CAS DataBase Reference | 56824-22-7(CAS DataBase Reference) |
Description and Uses
2-(2-Chloroethyl)-1-methylpyrrolidine hydrochloride was used in the synthesis of N-[2-(1-methylpyrrolidin-2-yl)ethyl]-N-(2-iodo-4,5-dimethoxyphenyl) amide. It was used as reagent during the synthesis of 1-methyl-2-[2-[2-(2-phenylethyl)phenoxy]ethyl]pyrrolidine hydrochlochloride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | QE0175000 |
| Storage Class | 11 - Combustible Solids |




