tert-Butyl1-hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oate , 98% , 361189-64-2
Synonym(s):
tert-Butyl 1-hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oate;HO-PEG6-CO-OtBu
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB240.00 | In Stock |
|
| 1g | RMB693.60 | In Stock |
|
| 5g | RMB2583.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 481.8±40.0 °C(Predicted) |
| Density | 1.076±0.06 g/cm3(Predicted) |
| refractive index | n/D 1.454 |
| storage temp. | -20°C |
| pka | 14.36±0.10(Predicted) |
| form | viscous liquid |
| color | Colourless |
| InChI | InChI=1S/C19H38O9/c1-19(2,3)28-18(21)4-6-22-8-10-24-12-14-26-16-17-27-15-13-25-11-9-23-7-5-20/h20H,4-17H2,1-3H3 |
| InChIKey | VGGDPFAYSOSIOK-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCO |
Description and Uses
Hydroxy-PEG6-t-butyl ester is a PEG linker containing a hydroxyl group with a t-butyl ester. The hydrophilic PEG spacer increases solubility in aqueous media. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The t-butyl protected carboxyl group can be deprotected under acidic conditions.
This heterobifunctional, PEGylated crosslinker features a hydroxyl group at one end and t-butyl-protected carboxylic acid at the other, which can be deprotected with acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. Hydroxy-PEG6-t-butyl ester can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or roteolysis-targeting chimeras (PROTAC molecules) for targeted protein degradation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2942000090 |
| Storage Class | 10 - Combustible liquids |






