BD8996731
(3R,5R)-tert-Butyl 7-(2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoate , 98% , 134395-00-9
CAS NO.：134395-00-9
Empirical Formula: C37H43FN2O5
Molecular Weight: 614.75
MDL number: MFCD09839952
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.80 | In Stock |
|
| 1g | RMB151.20 | In Stock |
|
| 5g | RMB456.80 | In Stock |
|
| 25g | RMB1370.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68°C |
| Boiling point: | 721.0±60.0 °C(Predicted) |
| Density | 1.16 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.57±0.70(Predicted) |
| color | White to Off-White |
| PH | 6.22 at 25℃ and 10mg/L |
| Major Application | pharmaceutical small molecule |
| InChIKey | GCPKKGVOCBYRML-LOYHVIPDSA-N |
| SMILES | Fc1ccc(cc1)c2[n](c(c(c2c4ccccc4)C(=O)Nc3ccccc3)C(C)C)CC[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C |
| CAS DataBase Reference | 134395-00-9 |
Description and Uses
An impurity arising in the synthesis of Atorvastatin
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P260-P273-P314-P391-P501 |
| target organs | Liver |
| WGK Germany | WGK 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 STOT RE 2 |
