PRODUCT Properties
| Boiling point: | 324.6±27.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 0.22±0.10(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Beige |
| InChI | InChI=1S/C8H8ClNO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,10H2,1H3 |
| InChIKey | VGVXDPRCTIRHOO-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(N)C(Cl)=C1)C |
Description and Uses
1-(4-Amino-3-chlorophenyl)ethanone is an intermediate to many COX-II selective inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2922390090 |
