BD9049331
2-(4,4-Dimethyl-1-cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane , 95% , 859217-67-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB56.00 | In Stock |
|
| 250mg | RMB82.40 | In Stock |
|
| 1g | RMB322.40 | In Stock |
|
| 5g | RMB1286.40 | In Stock |
|
| 10g | RMB2318.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 255℃ |
| Density | 0.94 |
| Flash point: | 108℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C14H25BO2/c1-12(2)9-7-11(8-10-12)15-16-13(3,4)14(5,6)17-15/h7H,8-10H2,1-6H3 |
| InChIKey | JQEUELMRQYUNDS-UHFFFAOYSA-N |
| SMILES | O1C(C)(C)C(C)(C)OB1C1CCC(C)(C)CC=1 |
Description and Uses
4,4-Dimethylcyclohexen-1-ylboronic acid, pinacol ester
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| WGK Germany | 3 |
| HS Code | 2931900090 |






