BD9055747
2-((4-Chloro-2-nitrophenyl)amino)ethanol , 95+% , 59320-13-7
Synonym(s):
2-(4-Chloro-2-nitroanilino)ethanol
CAS NO.:59320-13-7
Empirical Formula: C8H9ClN2O3
Molecular Weight: 216.62
MDL number: MFCD00545922
EINECS: 413-280-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB4898.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-108 °C |
| Boiling point: | 411.8±35.0 °C(Predicted) |
| Density | 1.476±0.06 g/cm3(Predicted) |
| pka | 14.57±0.10(Predicted) |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C8H9ClN2O3/c9-6-1-2-7(10-3-4-12)8(5-6)11(13)14/h1-2,5,10,12H,3-4H2 |
| InChIKey | LGGKGPQFSCBUOR-UHFFFAOYSA-N |
| SMILES | OCCNc1ccc(Cl)cc1[N+]([O-])=O |
Description and Uses
4-Chloro-N-(2-hydroxyethyl)-2-nitroaniline may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 22-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| F | 9 |
| REACH Registrations | Inactive |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |





