BD9077147
2-(2,6-Dimethylphenoxy)aceticacid , 98% , 13335-71-2
CAS NO.:13335-71-2
Empirical Formula: C10H12O3
Molecular Weight: 180.2
MDL number: MFCD00156912
EINECS: 430-910-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB69.60 | In Stock |
|
| 25g | RMB243.20 | In Stock |
|
| 100g | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-138°C |
| Boiling point: | 284-316℃ at 101.325kPa |
| Density | 1.257 at 20℃ |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Refrigerator |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | pK1:3.356 (25°C) |
| color | White |
| InChI | InChI=1S/C10H12O3/c1-7-4-3-5-8(2)10(7)13-6-9(11)12/h3-5H,6H2,1-2H3,(H,11,12) |
| InChIKey | MLBCURLNKYKBEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COC1=C(C)C=CC=C1C |
| LogP | 0.91 at 21℃ |
| Surface tension | 57.3-66.5mN/m at 100-1000mg/L and 20℃ |
| CAS DataBase Reference | 13335-71-2(CAS DataBase Reference) |
Description and Uses
(2,6-Dimethylphenoxy)acetic Acid (cas# 13335-71-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318-H412 |
| Precautionary statements | P264-P270-P273-P280-P301+P312+P330-P305+P351+P338+P310-P501 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2918999090 |
| REACH Registrations | Active |




![N-[(1S,2S,4S)-4-amino-2-hydroxy-5-phenyl-1-(phenylmethyl)pentyl]-2-(2,6-dimethylphenoxy)acetamide](https://img.chemicalbook.com/CAS/GIF/192725-49-8.gif)



