BD9078431
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpent-4-enoic acid , 97% , 288617-71-0
Synonym(s):
(S)-N-Fmoc-α-2-n-propenylalanine;Fmoc-(S)-2-(2-propenyl)alanine;Fmoc-(S)-2-amino-2-methyl-4-pentenoic acid
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB396.80 | In Stock |
|
| 250mg | RMB637.60 | In Stock |
|
| 1g | RMB1631.20 | In Stock |
|
| 5g | RMB6222.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 564.3±45.0 °C(Predicted) |
| Density | 1.224 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | 3.81±0.11(Predicted) |
| form | liquid |
| color | pale yellow |
| InChI | InChI=1S/C21H21NO4/c1-3-12-21(2,19(23)24)22-20(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h3-11,18H,1,12-13H2,2H3,(H,22,25)(H,23,24)/t21-/m0/s1 |
| InChIKey | FNCSRFHDUZYOCR-NRFANRHFSA-N |
| SMILES | C(O)(=O)[C@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CC=C |
Description and Uses
Olefinic alpha-methyl amino acid for peptide stapling. Upon incorporation of this amino acid into a peptide, along with another of the same or derivative with a different length of the olefinic side chain, the two can be ′stapled′ via a ring closing metathesis reaction with Grubb′s catalyst (product # 579726). The resulting stapled peptide macrocycle has been shown to stabilize the alpha-helical structure of peptides, which can lead to favorable biological characteristics such as increased proteolytic stability and cellular uptake.







