BD9219231
(S)-N-Fmoc-α-(4-pentenyl)alanine , 97%(>97%ee) , 288617-73-2
Synonym(s):
(S)-N-Fmoc-α-4-n-pentenylalanine;Fmoc-(S)-2-(4-pentenyl)alanine;Fmoc-(S)-2-amino-2-methyl-hept-6-enoic acid
CAS NO.:288617-73-2
Empirical Formula: C23H25NO4
Molecular Weight: 379.45
MDL number: MFCD09879888
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB80.00 | In Stock |
|
| 250mg | RMB164.80 | In Stock |
|
| 1g | RMB485.60 | In Stock |
|
| 5g | RMB1836.00 | In Stock |
|
| 25g | RMB6839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <30 °C |
| Boiling point: | 591.7±45.0 °C(Predicted) |
| Density | 1.185 |
| storage temp. | -20°C |
| pka | 3.91±0.41(Predicted) |
| form | liquid |
| color | pale yellow |
| Major Application | peptide synthesis |
| InChIKey | MRJFPZWLOJOINV-QHCPKHFHSA-N |
| SMILES | C(O)(=O)[C@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CCCC=C |
Description and Uses
(S)-2-(((9H-FLUOREN-9-YL)METHOXY)CARBONYLAMINO)-2-METHYLHEPT-6-ENOIC ACID is a product used for preparing stapled peptides by ring closing metathesis.
Fmoc-(S)-2-(4-pentenyl)Ala-OH is a Fmoc-protected amino acid that can be used to create peptide libraries.







