BD9082947
N1-(5-Nitropyridin-2-yl)ethane-1,2-diamine , 95+% , 29602-39-9
CAS NO.:29602-39-9
Empirical Formula: C7H10N4O2
Molecular Weight: 182.18
MDL number: MFCD00006254
EINECS: 249-721-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB2256.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128 °C(lit.) |
| Boiling point: | 315.57°C (rough estimate) |
| Density | 1.3129 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| pka | 9.00±0.10(Predicted) |
| Sensitive | Air Sensitive |
| InChI | 1S/C7H10N4O2/c8-3-4-9-7-2-1-6(5-10-7)11(12)13/h1-2,5H,3-4,8H2,(H,9,10) |
| InChIKey | ODHSPTHLPCXPTL-UHFFFAOYSA-N |
| SMILES | NCCNc1ccc(cn1)[N+]([O-])=O |
| CAS DataBase Reference | 29602-39-9(CAS DataBase Reference) |
Description and Uses
2-(2-Aminoethylamino)-5-nitropyridine is used in matrix preparation for the quantification of phospholipids (PLs) by MALDI-TOFMS.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | 8 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






