BD9088347
4-(Octyloxy)benzaldehyde , 98% , 24083-13-4
CAS NO.：24083-13-4
Empirical Formula: C15H22O2
Molecular Weight: 234.33
MDL number: MFCD00014136
EINECS: 246-012-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB90.40 | In Stock |
|
| 25g | RMB438.40 | In Stock |
|
| 100g | RMB1484.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140-142 °C (0.1 mmHg) |
| Density | 0.98 |
| refractive index | 1.52-1.522 |
| Flash point: | 140-142°C/0.1mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| Specific Gravity | 0.98 |
| Sensitive | Air Sensitive |
| BRN | 1913284 |
| InChI | InChI=1S/C15H22O2/c1-2-3-4-5-6-7-12-17-15-10-8-14(13-16)9-11-15/h8-11,13H,2-7,12H2,1H3 |
| InChIKey | KVOWZHASDIKNFK-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OCCCCCCCC)C=C1 |
| CAS DataBase Reference | 24083-13-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 4-(octyloxy)- (24083-13-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
