PRODUCT Properties
| Boiling point: | 108-110 °C2 mm Hg(lit.) |
| Density | 1.163 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | liquid |
| InChI | 1S/C10H9ClO/c11-10(12)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2/t8-,9+/m0/s1 |
| InChIKey | SODZBMGDYKEZJG-DTWKUNHWSA-N |
| SMILES | ClC(=O)[C@@H]1C[C@H]1c2ccccc2 |
Description and Uses
trans-2-Phenyl-1-cyclopropanecarbonyl chloride was used in the synthesis of series of trans-1-[(2-phenylcyclopropyl)methyl]-4-arylpiperazines.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | GZ0900000 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
