BD9096531
3-Benzyl-6-bromo-2-methoxyquinoline , 95% , 654655-69-3
CAS NO.:654655-69-3
Empirical Formula: C17H14BrNO
Molecular Weight: 328.2
MDL number: MFCD22493488
EINECS: 207-791-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB119.20 | In Stock |
|
| 10g | RMB197.60 | In Stock |
|
| 25g | RMB399.20 | In Stock |
|
| 100g | RMB1198.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-83℃ |
| Boiling point: | 420.5±40.0 °C(Predicted) |
| Density | 1.388±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.45±0.50(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C17H14BrNO/c1-20-17-14(9-12-5-3-2-4-6-12)10-13-11-15(18)7-8-16(13)19-17/h2-8,10-11H,9H2,1H3 |
| InChIKey | WMFHVNYOCKTDMX-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)C=C(CC2=CC=CC=C2)C=1OC |
Description and Uses
3-benzyl-6-bromo-2-methoxyquinoline is a reactant used in the preparation of Bedaquiline (B119550), a potential drug in the treatment of tuberculosis.






