BD9112947
2,6-Diiodo-4-nitrophenol , 95% , 305-85-1
CAS NO.:305-85-1
Empirical Formula: C6H3I2NO3
Molecular Weight: 390.9
MDL number: MFCD00007335
EINECS: 206-170-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB124.80 | In Stock |
|
| 250mg | RMB212.00 | In Stock |
|
| 1g | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-154 °C(lit.) |
| Boiling point: | 310.6±42.0 °C(Predicted) |
| Density | 2.5630 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.85±0.44(Predicted) |
| color | Pale Yellow |
| Water Solubility | very sparingly soluble |
| Sensitive | Light Sensitive |
| Merck | 14,3359 |
| BRN | 2052233 |
| Stability: | Stable. |
| InChI | InChI=1S/C6H3I2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
| InChIKey | UVGTXNPVQOQFQW-UHFFFAOYSA-N |
| SMILES | C1(O)=C(I)C=C([N+]([O-])=O)C=C1I |
| CAS DataBase Reference | 305-85-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Diiodo-4-nitrophenol(305-85-1) |
| EPA Substance Registry System | 2,6-Diiodo-4-nitrophenol (305-85-1) |
Description and Uses
2,6-Diiodo-4-nitrophenol is useful for statistical methods for developing QSARs to predict toxicity of phenols to Tetrahymena pyriformis.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P310-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xn,T |
| Risk Statements | 20/21/22-36/37/38-25 |
| Safety Statements | 26-28-36/37/39-45-28A |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SL0750000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| Toxicity | LD50 in rats, mice (mg/kg): 170, 212 orally; 105, 88 i.v.; 105, 107 i.p.; 122, 110 s.c. (Kaiser) |




