BD9170747
Glupa-CarboxylateMonoammonium , 98+% , 63699-78-5
Synonym(s):
L -Glutamic acid 5-(3-carboxy-4-nitroanilide) ammonium salt
CAS NO.:63699-78-5
Empirical Formula: C12H16N4O7
Molecular Weight: 328.28
MDL number: MFCD00058243
EINECS: 264-418-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2776.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | H2O: 100 mg/mL, clear, yellow-green |
| form | Solid |
| color | Light yellow to yellow |
| Water Solubility | H2O: 100mg/mL, clear, yellow-green |
| InChI | InChI=1/C12H13N3O7.H3N/c13-8(12(19)20)2-4-10(16)14-6-1-3-9(15(21)22)7(5-6)11(17)18;/h1,3,5,8H,2,4,13H2,(H,14,16)(H,17,18)(H,19,20);1H3/t8-;/s3 |
| InChIKey | GFABNNMTRVBLPZ-JNODIIHCNA-N |
| SMILES | C1(C(=O)O)C=C(C=CC=1[N+]([O-])=O)NC(=O)CC[C@H](N)C(=O)O.N |&1:17,r| |
Description and Uses
L-Glutamic acid γ-(3-carboxy-4-nitroanilide) ammonium salt has been used as a synthetic substrate for gamma-glutamyltransferase (GGT) to determine GGT activity.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |






