PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 228-229 °C (lit.) |
| Density | 0.925 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 198 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | liquid |
| color | Colorless to Almost colorless |
| optical activity | [α]/D +78.5±1°, neat |
| BRN | 1909419 |
| InChI | 1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m0/s1 |
| InChIKey | XHXUANMFYXWVNG-WCQGTBRESA-N |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(C)=O |
| CAS DataBase Reference | 5157-89-1 |
Description and Uses
Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2915.39.9000 |
| Storage Class | 10 - Combustible liquids |
