BD9213331
Methyl bromopyruvate , 80% , 7425-63-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB80.00 | In Stock |
|
| 100g | RMB313.60 | In Stock |
|
| 500g | RMB1412.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 5°C(lit.) |
| Boiling point: | 84°C/10mmHg(lit.) |
| Density | 1.70 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| BRN | 1754888 |
| InChI | InChI=1S/C4H5BrO3/c1-8-4(7)3(6)2-5/h2H2,1H3 |
| InChIKey | MQONVZMIFQQQHA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(=O)CBr |
| CAS DataBase Reference | 7425-63-0(CAS DataBase Reference) |
Description and Uses
Methyl bromopyruvate was used in the synthesis of 2-(4-amino-4-carboxybutyl)thiazole-4-carboxylic acid and methyl-1-(bromomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| F | 19 |
| HS Code | 2918300090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





